C26H33N3O4 — CID 90966502
benzyl N-[6-[[2-(5-methoxy-2-methylindol-1-yl)acetyl]amino]hexyl]carbamate (PubChem CID 90966502) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is benzyl N-[6-[[2-(5-methoxy-2-methylindol-1-yl)acetyl]amino]hexyl]carbamate.
| Compound Name | benzyl N-[6-[[2-(5-methoxy-2-methylindol-1-yl)acetyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 90966502 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | benzyl N-[6-[[2-(5-methoxy-2-methylindol-1-yl)acetyl]amino]hexyl]carbamate |
| SMILES | COc1ccc2c(c1)cc(C)n2CC(=O)NCCCCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H33N3O4/c1-20-16-22-17-23(32-2)12-13-24(22)29(20)18-25(30)27-14-8-3-4-9-15-28-26(31)33-19-21-10-6-5-7-11-21/h5-7,10-13,16-17H,3-4,8-9,14-15,18-19H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | FDYZAYISMPZKBH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|