C27H30O9 — CID 90967331
(4S,5S)-18-hydroxy-16-methoxy-5-[(4-methoxyphenyl)methoxy]-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone (PubChem CID 90967331) has the molecular formula C27H30O9 and a molecular weight of 498.53 g/mol. Its IUPAC name is (4S,5S)-18-hydroxy-16-methoxy-5-[(4-methoxyphenyl)methoxy]-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone.
| Compound Name | (4S,5S)-18-hydroxy-16-methoxy-5-[(4-methoxyphenyl)methoxy]-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
|---|---|
| PubChem CID | 90967331 |
| Molecular Formula | C27H30O9 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | (4S,5S)-18-hydroxy-16-methoxy-5-[(4-methoxyphenyl)methoxy]-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
| SMILES | COc1ccc(CO[C@H]2CCC(=O)C(=O)C(=O)CCCc3cc(OC)cc(O)c3C(=O)O[C@H]2C)cc1 |
| InChI | InChI=1S/C27H30O9/c1-16-24(35-15-17-7-9-19(33-2)10-8-17)12-11-22(29)26(31)21(28)6-4-5-18-13-20(34-3)14-23(30)25(18)27(32)36-16/h7-10,13-14,16,24,30H,4-6,11-12,15H2,1-3H3/t16-,24-/m0/s1 |
| InChIKey | QLEGBAAAGIUXBV-FYSMJZIKSA-N |
| XLogP | 3.36 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|