C20H23BrO7 — CID 90763490
(4S,5R)-15-bromo-18-hydroxy-16-methoxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone (PubChem CID 90763490) has the molecular formula C20H23BrO7 and a molecular weight of 455.30 g/mol. Its IUPAC name is (4S,5R)-15-bromo-18-hydroxy-16-methoxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone.
| Compound Name | (4S,5R)-15-bromo-18-hydroxy-16-methoxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
|---|---|
| PubChem CID | 90763490 |
| Molecular Formula | C20H23BrO7 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | (4S,5R)-15-bromo-18-hydroxy-16-methoxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
| SMILES | COc1cc(O)c2c(c1Br)CCCC(=O)C(=O)C(=O)CC[C@@H](C)[C@H](C)OC2=O |
| InChI | InChI=1S/C20H23BrO7/c1-10-7-8-14(23)19(25)13(22)6-4-5-12-17(20(26)28-11(10)2)15(24)9-16(27-3)18(12)21/h9-11,24H,4-8H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | WKYYSZWNPSQFCW-MNOVXSKESA-N |
| XLogP | 3.17 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|