C24H27NO8 — CID 91065137
3-[(4S,5R)-18-hydroxy-4,5-dimethyl-2,8,9,10-tetraoxo-3-oxabicyclo[12.4.0]octadeca-1(18),14,16-trien-15-yl]prop-2-ynyl N-methylcarbamate (PubChem CID 91065137) has the molecular formula C24H27NO8 and a molecular weight of 457.48 g/mol. Its IUPAC name is 3-[(4S,5R)-18-hydroxy-4,5-dimethyl-2,8,9,10-tetraoxo-3-oxabicyclo[12.4.0]octadeca-1(18),14,16-trien-15-yl]prop-2-ynyl N-methylcarbamate.
| Compound Name | 3-[(4S,5R)-18-hydroxy-4,5-dimethyl-2,8,9,10-tetraoxo-3-oxabicyclo[12.4.0]octadeca-1(18),14,16-trien-15-yl]prop-2-ynyl N-methylcarbamate |
|---|---|
| PubChem CID | 91065137 |
| Molecular Formula | C24H27NO8 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 3-[(4S,5R)-18-hydroxy-4,5-dimethyl-2,8,9,10-tetraoxo-3-oxabicyclo[12.4.0]octadeca-1(18),14,16-trien-15-yl]prop-2-ynyl N-methylcarbamate |
| SMILES | CNC(=O)OCC#Cc1ccc(O)c2c1CCCC(=O)C(=O)C(=O)CC[C@@H](C)[C@H](C)OC2=O |
| InChI | InChI=1S/C24H27NO8/c1-14-9-11-20(28)22(29)19(27)8-4-7-17-16(6-5-13-32-24(31)25-3)10-12-18(26)21(17)23(30)33-15(14)2/h10,12,14-15,26H,4,7-9,11,13H2,1-3H3,(H,25,31)/t14-,15+/m1/s1 |
| InChIKey | KHRCPJKDMWXMBW-CABCVRRESA-N |
| XLogP | 2.10 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|