C21H22O7 — CID 91564569
(4S,5S)-21-hydroxy-4,5-dimethyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),15(19),16,20-tetraene-2,8,9,10-tetrone (PubChem CID 91564569) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is (4S,5S)-21-hydroxy-4,5-dimethyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),15(19),16,20-tetraene-2,8,9,10-tetrone.
| Compound Name | (4S,5S)-21-hydroxy-4,5-dimethyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),15(19),16,20-tetraene-2,8,9,10-tetrone |
|---|---|
| PubChem CID | 91564569 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (4S,5S)-21-hydroxy-4,5-dimethyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),15(19),16,20-tetraene-2,8,9,10-tetrone |
| SMILES | C[C@@H]1OC(=O)c2c(O)cc3occc3c2CCCC(=O)C(=O)C(=O)CC[C@@H]1C |
| InChI | InChI=1S/C21H22O7/c1-11-6-7-16(23)20(25)15(22)5-3-4-14-13-8-9-27-18(13)10-17(24)19(14)21(26)28-12(11)2/h8-12,24H,3-7H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | RSXXHUVFIMRMLO-RYUDHWBXSA-N |
| XLogP | 3.14 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|