C20H20O6 — CID 58750363
(4S,6Z,10S,12E)-10,21-dihydroxy-4-methyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaene-2,8-dione (PubChem CID 58750363) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is (4S,6Z,10S,12E)-10,21-dihydroxy-4-methyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaene-2,8-dione.
| Compound Name | (4S,6Z,10S,12E)-10,21-dihydroxy-4-methyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaene-2,8-dione |
|---|---|
| PubChem CID | 58750363 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (4S,6Z,10S,12E)-10,21-dihydroxy-4-methyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaene-2,8-dione |
| SMILES | C[C@H]1C/C=C\C(=O)C[C@@H](O)C/C=C/c2c(c(O)cc3occc23)C(=O)O1 |
| InChI | InChI=1S/C20H20O6/c1-12-4-2-5-13(21)10-14(22)6-3-7-16-15-8-9-25-18(15)11-17(23)19(16)20(24)26-12/h2-3,5,7-9,11-12,14,22-23H,4,6,10H2,1H3/b5-2-,7-3+/t12-,14-/m0/s1 |
| InChIKey | PFEGEKMBLUOXOE-DSEIBJCBSA-N |
| XLogP | 3.37 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |