C22H30O7 — CID 162238657
(4S,6Z,10S,12E)-10,18-dihydroxy-15-(4-hydroxybutyl)-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaene-2,8-dione;hydrate (PubChem CID 162238657) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is (4S,6Z,10S,12E)-10,18-dihydroxy-15-(4-hydroxybutyl)-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaene-2,8-dione;hydrate.
| Compound Name | (4S,6Z,10S,12E)-10,18-dihydroxy-15-(4-hydroxybutyl)-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaene-2,8-dione;hydrate |
|---|---|
| PubChem CID | 162238657 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (4S,6Z,10S,12E)-10,18-dihydroxy-15-(4-hydroxybutyl)-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaene-2,8-dione;hydrate |
| SMILES | C[C@H]1C/C=C\C(=O)C[C@@H](O)C/C=C/c2c(CCCCO)ccc(O)c2C(=O)O1.O |
| InChI | InChI=1S/C22H28O6.H2O/c1-15-6-4-8-17(24)14-18(25)9-5-10-19-16(7-2-3-13-23)11-12-20(26)21(19)22(27)28-15;/h4-5,8,10-12,15,18,23,25-26H,2-3,6-7,9,13-14H2,1H3;1H2/b8-4-,10-5+;/t15-,18-;/m0./s1 |
| InChIKey | YODJPTNOZNXPNG-ONUVXCKMSA-N |
| XLogP | 2.11 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|