C27H36O8 — CID 157219590
(5S,9S,11Z,13R,14S)-21-(3-hydroxypropyl)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione (PubChem CID 157219590) has the molecular formula C27H36O8 and a molecular weight of 488.58 g/mol. Its IUPAC name is (5S,9S,11Z,13R,14S)-21-(3-hydroxypropyl)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione.
| Compound Name | (5S,9S,11Z,13R,14S)-21-(3-hydroxypropyl)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione |
|---|---|
| PubChem CID | 157219590 |
| Molecular Formula | C27H36O8 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | (5S,9S,11Z,13R,14S)-21-(3-hydroxypropyl)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione |
| SMILES | COCOc1ccc(CCCO)c2c1C(=O)O[C@@H](C)[C@H](C)/C=C\C(=O)[C@H]1OC(C)(C)O[C@H]1CC=C2 |
| InChI | InChI=1S/C27H36O8/c1-17-11-13-21(29)25-23(34-27(3,4)35-25)10-6-9-20-19(8-7-15-28)12-14-22(32-16-31-5)24(20)26(30)33-18(17)2/h6,9,11-14,17-18,23,25,28H,7-8,10,15-16H2,1-5H3/b9-6?,13-11-/t17-,18+,23+,25-/m1/s1 |
| InChIKey | NLTRENGPPVNUFU-UDKLTSMQSA-N |
| XLogP | 3.84 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|