C18H20ClNO6 — CID 91572735
(4S)-15-chloro-16,18-dihydroxy-4-methyl-3-azabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone (PubChem CID 91572735) has the molecular formula C18H20ClNO6 and a molecular weight of 381.81 g/mol. Its IUPAC name is (4S)-15-chloro-16,18-dihydroxy-4-methyl-3-azabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone.
| Compound Name | (4S)-15-chloro-16,18-dihydroxy-4-methyl-3-azabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
|---|---|
| PubChem CID | 91572735 |
| Molecular Formula | C18H20ClNO6 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (4S)-15-chloro-16,18-dihydroxy-4-methyl-3-azabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
| SMILES | C[C@H]1CCCC(=O)C(=O)C(=O)CCCc2c(Cl)c(O)cc(O)c2C(=O)N1 |
| InChI | InChI=1S/C18H20ClNO6/c1-9-4-2-6-11(21)17(25)12(22)7-3-5-10-15(18(26)20-9)13(23)8-14(24)16(10)19/h8-9,23-24H,2-7H2,1H3,(H,20,26)/t9-/m0/s1 |
| InChIKey | GICKWXDGOSHGAJ-VIFPVBQESA-N |
| XLogP | 2.08 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|