C20H22O8 — CID 90801608
methyl (4S)-18-hydroxy-4-methyl-2,8,9,10-tetraoxo-3-oxabicyclo[12.4.0]octadeca-1(18),14,16-triene-15-carboxylate (PubChem CID 90801608) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is methyl (4S)-18-hydroxy-4-methyl-2,8,9,10-tetraoxo-3-oxabicyclo[12.4.0]octadeca-1(18),14,16-triene-15-carboxylate.
| Compound Name | methyl (4S)-18-hydroxy-4-methyl-2,8,9,10-tetraoxo-3-oxabicyclo[12.4.0]octadeca-1(18),14,16-triene-15-carboxylate |
|---|---|
| PubChem CID | 90801608 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | methyl (4S)-18-hydroxy-4-methyl-2,8,9,10-tetraoxo-3-oxabicyclo[12.4.0]octadeca-1(18),14,16-triene-15-carboxylate |
| SMILES | COC(=O)c1ccc(O)c2c1CCCC(=O)C(=O)C(=O)CCC[C@H](C)OC2=O |
| InChI | InChI=1S/C20H22O8/c1-11-5-3-7-15(22)18(24)16(23)8-4-6-12-13(19(25)27-2)9-10-14(21)17(12)20(26)28-11/h9-11,21H,3-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | NLENROPNUDIXDX-NSHDSACASA-N |
| XLogP | 1.94 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|