C22H37NO5S — CID 90967618
2-hydroxy-3-[3-(octanoylamino)octyl]benzenesulfonic acid (PubChem CID 90967618) has the molecular formula C22H37NO5S and a molecular weight of 427.61 g/mol. Its IUPAC name is 2-hydroxy-3-[3-(octanoylamino)octyl]benzenesulfonic acid.
| Compound Name | 2-hydroxy-3-[3-(octanoylamino)octyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 90967618 |
| Molecular Formula | C22H37NO5S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 2-hydroxy-3-[3-(octanoylamino)octyl]benzenesulfonic acid |
| SMILES | CCCCCCCC(=O)NC(CCCCC)CCc1cccc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C22H37NO5S/c1-3-5-7-8-10-15-21(24)23-19(13-9-6-4-2)17-16-18-12-11-14-20(22(18)25)29(26,27)28/h11-12,14,19,25H,3-10,13,15-17H2,1-2H3,(H,23,24)(H,26,27,28) |
| InChIKey | ACACNOPSUITIHC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|