C30H36F3N9O — CID 90970375
N-[5-[amino-[2-imino-2-[5-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)-3-pyridinyl]ethyl]amino]-6-methyl-3-pyridinyl]-4-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 90970375) has the molecular formula C30H36F3N9O and a molecular weight of 595.67 g/mol. Its IUPAC name is N-[5-[amino-[2-imino-2-[5-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)-3-pyridinyl]ethyl]amino]-6-methyl-3-pyridinyl]-4-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[5-[amino-[2-imino-2-[5-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)-3-pyridinyl]ethyl]amino]-6-methyl-3-pyridinyl]-4-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90970375 |
| Molecular Formula | C30H36F3N9O |
| Molecular Weight | 595.67 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | N-[5-[amino-[2-imino-2-[5-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)-3-pyridinyl]ethyl]amino]-6-methyl-3-pyridinyl]-4-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | [H]/N=C(\CN(N)c1cc(NC(=O)c2cc(C(F)(F)F)ccn2)cnc1C)c1cncc(N2CCC3(CCN(C)CC3)CC2)c1 |
| InChI | InChI=1S/C30H36F3N9O/c1-20-27(15-23(17-38-20)39-28(43)26-14-22(3-8-37-26)30(31,32)33)42(35)19-25(34)21-13-24(18-36-16-21)41-11-6-29(7-12-41)4-9-40(2)10-5-29/h3,8,13-18,34H,4-7,9-12,19,35H2,1-2H3,(H,39,43)/b34-25+ |
| InChIKey | YCXSRDVSYPLMCA-YQCHCMBFSA-N |
| XLogP | 4.51 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|