C32H47NO4Si — CID 90970879
[(5S)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-3-benzamido-3-phenyl-2-triethylsilyloxypropanoate (PubChem CID 90970879) has the molecular formula C32H47NO4Si and a molecular weight of 537.82 g/mol. Its IUPAC name is [(5S)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-3-benzamido-3-phenyl-2-triethylsilyloxypropanoate.
| Compound Name | [(5S)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-3-benzamido-3-phenyl-2-triethylsilyloxypropanoate |
|---|---|
| PubChem CID | 90970879 |
| Molecular Formula | C32H47NO4Si |
| Molecular Weight | 537.82 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | [(5S)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-3-benzamido-3-phenyl-2-triethylsilyloxypropanoate |
| SMILES | CC[Si](CC)(CC)O[C@@H](C(=O)OC1C[C@@H](C)CCC1C(C)C)[C@@H](NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H47NO4Si/c1-7-38(8-2,9-3)37-30(32(35)36-28-22-24(6)20-21-27(28)23(4)5)29(25-16-12-10-13-17-25)33-31(34)26-18-14-11-15-19-26/h10-19,23-24,27-30H,7-9,20-22H2,1-6H3,(H,33,34)/t24-,27?,28?,29-,30+/m0/s1 |
| InChIKey | BDZDEOBIQRGPFS-UIBNLCEQSA-N |
| XLogP | 7.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.82 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|