C22H25N5O2S2 — CID 90971071
6-[3-[[3-(3-hydroxypiperidin-1-yl)phenoxy]methylamino]anilino]-1H-pyrimidine-2,4-dithione (PubChem CID 90971071) has the molecular formula C22H25N5O2S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is 6-[3-[[3-(3-hydroxypiperidin-1-yl)phenoxy]methylamino]anilino]-1H-pyrimidine-2,4-dithione.
| Compound Name | 6-[3-[[3-(3-hydroxypiperidin-1-yl)phenoxy]methylamino]anilino]-1H-pyrimidine-2,4-dithione |
|---|---|
| PubChem CID | 90971071 |
| Molecular Formula | C22H25N5O2S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 6-[3-[[3-(3-hydroxypiperidin-1-yl)phenoxy]methylamino]anilino]-1H-pyrimidine-2,4-dithione |
| SMILES | OC1CCCN(c2cccc(OCNc3cccc(Nc4cc(=S)[nH]c(=S)[nH]4)c3)c2)C1 |
| InChI | InChI=1S/C22H25N5O2S2/c28-18-7-3-9-27(13-18)17-6-2-8-19(11-17)29-14-23-15-4-1-5-16(10-15)24-20-12-21(30)26-22(31)25-20/h1-2,4-6,8,10-12,18,23,28H,3,7,9,13-14H2,(H3,24,25,26,30,31) |
| InChIKey | BUQLBCKWXWHGPD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|