C17H17ClO4S — CID 9097345
(3,4-dimethylphenyl) 3-(4-chlorophenyl)sulfonylpropanoate (PubChem CID 9097345) has the molecular formula C17H17ClO4S and a molecular weight of 352.84 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 3-(4-chlorophenyl)sulfonylpropanoate.
| Compound Name | (3,4-dimethylphenyl) 3-(4-chlorophenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 9097345 |
| Molecular Formula | C17H17ClO4S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | (3,4-dimethylphenyl) 3-(4-chlorophenyl)sulfonylpropanoate |
| SMILES | Cc1ccc(OC(=O)CCS(=O)(=O)c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C17H17ClO4S/c1-12-3-6-15(11-13(12)2)22-17(19)9-10-23(20,21)16-7-4-14(18)5-8-16/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | XJNZPEPPHQWAIS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|