C20H23ClO4S — CID 16550533
(4-tert-butyl-2-methylphenyl) 3-(4-chlorophenyl)sulfonylpropanoate (PubChem CID 16550533) has the molecular formula C20H23ClO4S and a molecular weight of 394.92 g/mol. Its IUPAC name is (4-tert-butyl-2-methylphenyl) 3-(4-chlorophenyl)sulfonylpropanoate.
| Compound Name | (4-tert-butyl-2-methylphenyl) 3-(4-chlorophenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 16550533 |
| Molecular Formula | C20H23ClO4S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (4-tert-butyl-2-methylphenyl) 3-(4-chlorophenyl)sulfonylpropanoate |
| SMILES | Cc1cc(C(C)(C)C)ccc1OC(=O)CCS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClO4S/c1-14-13-15(20(2,3)4)5-10-18(14)25-19(22)11-12-26(23,24)17-8-6-16(21)7-9-17/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | WJBDJOJUOODOSQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|