C15H27NO2 — CID 90976163
3,7,7-trimethyl-5-(2-methylpropyl)-4,4a,5,6,8,8a-hexahydrobenzo[e][1,3]oxazin-2-one (PubChem CID 90976163) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 3,7,7-trimethyl-5-(2-methylpropyl)-4,4a,5,6,8,8a-hexahydrobenzo[e][1,3]oxazin-2-one.
| Compound Name | 3,7,7-trimethyl-5-(2-methylpropyl)-4,4a,5,6,8,8a-hexahydrobenzo[e][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 90976163 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 3,7,7-trimethyl-5-(2-methylpropyl)-4,4a,5,6,8,8a-hexahydrobenzo[e][1,3]oxazin-2-one |
| SMILES | CC(C)CC1CC(C)(C)CC2OC(=O)N(C)CC12 |
| InChI | InChI=1S/C15H27NO2/c1-10(2)6-11-7-15(3,4)8-13-12(11)9-16(5)14(17)18-13/h10-13H,6-9H2,1-5H3 |
| InChIKey | SYRZQAGLKABCMJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |