C18H22BN2+ — CID 90977332
11-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-11-aza-7-azonia-1-boratricyclo[7.4.0.02,7]trideca-2(7),5,9,12-tetraene (PubChem CID 90977332) has the molecular formula C18H22BN2+ and a molecular weight of 277.20 g/mol. Its IUPAC name is 11-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-11-aza-7-azonia-1-boratricyclo[7.4.0.02,7]trideca-2(7),5,9,12-tetraene.
| Compound Name | 11-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-11-aza-7-azonia-1-boratricyclo[7.4.0.02,7]trideca-2(7),5,9,12-tetraene |
|---|---|
| PubChem CID | 90977332 |
| Molecular Formula | C18H22BN2+ |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 11-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-11-aza-7-azonia-1-boratricyclo[7.4.0.02,7]trideca-2(7),5,9,12-tetraene |
| SMILES | CC1=C(N2C=CB3C(=C2)C[N+]2=C3CCC=C2)C(C)CC=C1 |
| InChI | InChI=1S/C18H22BN2/c1-14-6-5-7-15(2)18(14)21-11-9-19-16(13-21)12-20-10-4-3-8-17(19)20/h4-6,9-11,13,15H,3,7-8,12H2,1-2H3/q+1 |
| InChIKey | QDPWHJKJGZWYIY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|