C19H24N3+ — CID 138398560
3-(4-indol-2-ylidene-1-pyridinyl)propyl-trimethylazanium (PubChem CID 138398560) has the molecular formula C19H24N3+ and a molecular weight of 294.42 g/mol. Its IUPAC name is 3-(4-indol-2-ylidene-1-pyridinyl)propyl-trimethylazanium.
| Compound Name | 3-(4-indol-2-ylidene-1-pyridinyl)propyl-trimethylazanium |
|---|---|
| PubChem CID | 138398560 |
| Molecular Formula | C19H24N3+ |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 3-(4-indol-2-ylidene-1-pyridinyl)propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCN1C=CC(=C2C=c3ccccc3=N2)C=C1 |
| InChI | InChI=1S/C19H24N3/c1-22(2,3)14-6-11-21-12-9-16(10-13-21)19-15-17-7-4-5-8-18(17)20-19/h4-5,7-10,12-13,15H,6,11,14H2,1-3H3/q+1 |
| InChIKey | QEIIPSDHTBCWSF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|