C17H22N3+ — CID 138400456
trimethyl(3-pyrido[4,3-b]indol-2-ylpropyl)azanium (PubChem CID 138400456) has the molecular formula C17H22N3+ and a molecular weight of 268.38 g/mol. Its IUPAC name is trimethyl(3-pyrido[4,3-b]indol-2-ylpropyl)azanium.
| Compound Name | trimethyl(3-pyrido[4,3-b]indol-2-ylpropyl)azanium |
|---|---|
| PubChem CID | 138400456 |
| Molecular Formula | C17H22N3+ |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | trimethyl(3-pyrido[4,3-b]indol-2-ylpropyl)azanium |
| SMILES | C[N+](C)(C)CCCn1ccc2nc3ccccc3c-2c1 |
| InChI | InChI=1S/C17H22N3/c1-20(2,3)12-6-10-19-11-9-17-15(13-19)14-7-4-5-8-16(14)18-17/h4-5,7-9,11,13H,6,10,12H2,1-3H3/q+1 |
| InChIKey | PVJMPAJZIXHMBO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|