About 4,5-dimethyl-2-propan-2-yl-3,4-dihydro-2H-pyrrole
4,5-dimethyl-2-propan-2-yl-3,4-dihydro-2H-pyrrole (PubChem CID 90978080) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 4,5-dimethyl-2-propan-2-yl-3,4-dihydro-2H-pyrrole.
Analyze 4,5-dimethyl-2-propan-2-yl-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-propan-2-yl-3,4-dihydro-2H-pyrrole?
The IUPAC name of 4,5-dimethyl-2-propan-2-yl-3,4-dihydro-2H-pyrrole (CID 90978080) is 4,5-dimethyl-2-propan-2-yl-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 4,5-dimethyl-2-propan-2-yl-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 4,5-dimethyl-2-propan-2-yl-3,4-dihydro-2H-pyrrole is CC1=NC(C(C)C)CC1C.
What is the InChIKey of 4,5-dimethyl-2-propan-2-yl-3,4-dihydro-2H-pyrrole?
The InChIKey is CAJYVWPGCKACFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-6(2)9-5-7(3)8(4)10-9/h6-7,9H,5H2,1-4H3.
What are the key properties of 4,5-dimethyl-2-propan-2-yl-3,4-dihydro-2H-pyrrole?
4,5-dimethyl-2-propan-2-yl-3,4-dihydro-2H-pyrrole has a molecular weight of 139.24 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-propan-2-yl-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 90978080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).