About 3-propan-2-yl-5-propan-2-ylidene-3,4-dihydropyrazole
3-propan-2-yl-5-propan-2-ylidene-3,4-dihydropyrazole (PubChem CID 58926371) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-propan-2-yl-5-propan-2-ylidene-3,4-dihydropyrazole.
Analyze 3-propan-2-yl-5-propan-2-ylidene-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-5-propan-2-ylidene-3,4-dihydropyrazole?
The IUPAC name of 3-propan-2-yl-5-propan-2-ylidene-3,4-dihydropyrazole (CID 58926371) is 3-propan-2-yl-5-propan-2-ylidene-3,4-dihydropyrazole.
What is the SMILES notation for 3-propan-2-yl-5-propan-2-ylidene-3,4-dihydropyrazole?
The canonical SMILES for 3-propan-2-yl-5-propan-2-ylidene-3,4-dihydropyrazole is CC(C)=C1CC(C(C)C)N=N1.
What is the InChIKey of 3-propan-2-yl-5-propan-2-ylidene-3,4-dihydropyrazole?
The InChIKey is KTZNGDXAVOEZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-6(2)8-5-9(7(3)4)11-10-8/h6,8H,5H2,1-4H3.
What are the key properties of 3-propan-2-yl-5-propan-2-ylidene-3,4-dihydropyrazole?
3-propan-2-yl-5-propan-2-ylidene-3,4-dihydropyrazole has a molecular weight of 152.24 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-5-propan-2-ylidene-3,4-dihydropyrazole is sourced from PubChem (CID 58926371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).