C22H21BrN2O8 — CID 90979072
(4S,12aS)-7-bromo-4-(dimethylamino)-9-formyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90979072) has the molecular formula C22H21BrN2O8 and a molecular weight of 521.32 g/mol. Its IUPAC name is (4S,12aS)-7-bromo-4-(dimethylamino)-9-formyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-7-bromo-4-(dimethylamino)-9-formyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90979072 |
| Molecular Formula | C22H21BrN2O8 |
| Molecular Weight | 521.32 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | (4S,12aS)-7-bromo-4-(dimethylamino)-9-formyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)c(C=O)cc(Br)c4CC3CC12 |
| InChI | InChI=1S/C22H21BrN2O8/c1-25(2)15-10-4-7-3-9-11(23)5-8(6-26)16(27)13(9)17(28)12(7)19(30)22(10,33)20(31)14(18(15)29)21(24)32/h5-7,10,12,14-15,27,33H,3-4H2,1-2H3,(H2,24,32)/t7?,10?,12?,14?,15-,22-/m0/s1 |
| InChIKey | ONWMTVSFSJCIOZ-RJVGIARUSA-N |
| XLogP | -0.56 |
| TPSA | 172.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.32 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|