C10H8Cl2N4 — CID 90979911
6-(2,5-dichlorophenyl)pyridazine-3,5-diamine (PubChem CID 90979911) has the molecular formula C10H8Cl2N4 and a molecular weight of 255.11 g/mol. Its IUPAC name is 6-(2,5-dichlorophenyl)pyridazine-3,5-diamine.
| Compound Name | 6-(2,5-dichlorophenyl)pyridazine-3,5-diamine |
|---|---|
| PubChem CID | 90979911 |
| Molecular Formula | C10H8Cl2N4 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 6-(2,5-dichlorophenyl)pyridazine-3,5-diamine |
| SMILES | Nc1cc(N)c(-c2cc(Cl)ccc2Cl)nn1 |
| InChI | InChI=1S/C10H8Cl2N4/c11-5-1-2-7(12)6(3-5)10-8(13)4-9(14)15-16-10/h1-4H,(H4,13,14,15) |
| InChIKey | DRNLAUIXXJKAGI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |