C14H17N3 — CID 90980384
7-benzyl-4,4a,5,6-tetrahydro-1H-pyrido[3,4-d]pyrimidine (PubChem CID 90980384) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 7-benzyl-4,4a,5,6-tetrahydro-1H-pyrido[3,4-d]pyrimidine.
| Compound Name | 7-benzyl-4,4a,5,6-tetrahydro-1H-pyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 90980384 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 7-benzyl-4,4a,5,6-tetrahydro-1H-pyrido[3,4-d]pyrimidine |
| SMILES | C1=NCC2CCN(Cc3ccccc3)C=C2N1 |
| InChI | InChI=1S/C14H17N3/c1-2-4-12(5-3-1)9-17-7-6-13-8-15-11-16-14(13)10-17/h1-5,10-11,13H,6-9H2,(H,15,16) |
| InChIKey | OPNMUBNQOSPIFX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |