C14H15N3O — CID 175687237
7-benzyl-3,4a,5,6-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 175687237) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 7-benzyl-3,4a,5,6-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-benzyl-3,4a,5,6-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 175687237 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 7-benzyl-3,4a,5,6-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=C1NC=NC2=CN(Cc3ccccc3)CCC12 |
| InChI | InChI=1S/C14H15N3O/c18-14-12-6-7-17(9-13(12)15-10-16-14)8-11-4-2-1-3-5-11/h1-5,9-10,12H,6-8H2,(H,15,16,18) |
| InChIKey | LLQATABALSKBAZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |