About 4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete
4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete (PubChem CID 90980477) has the molecular formula C11H13NO2S
and a molecular weight of 223.30 g/mol. Its IUPAC name is 4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete.
Molecular Properties
| Compound Name | 4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete |
| PubChem CID | 90980477 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete |
| SMILES | CS(=O)(=O)C(C1=NCC1)c1ccccc1 |
| InChI | InChI=1S/C11H13NO2S/c1-15(13,14)11(10-7-8-12-10)9-5-3-2-4-6-9/h2-6,11H,7-8H2,1H3 |
| InChIKey | CYQNIBZTXVBRAO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete?
The IUPAC name of 4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete (CID 90980477) is 4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete.
What is the SMILES notation for 4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete?
The canonical SMILES for 4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete is CS(=O)(=O)C(C1=NCC1)c1ccccc1.
What is the InChIKey of 4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete?
The InChIKey is CYQNIBZTXVBRAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2S/c1-15(13,14)11(10-7-8-12-10)9-5-3-2-4-6-9/h2-6,11H,7-8H2,1H3.
What are the key properties of 4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete?
4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete has a molecular weight of 223.30 g/mol, XLogP of 1.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[methylsulfonyl(phenyl)methyl]-2,3-dihydroazete is sourced from PubChem (CID 90980477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).