C25H23N3O4 — CID 90981039
3-[10-(hydroxymethyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]-4-(6-methoxy-1H-indol-3-yl)-1H-pyrrole-2,5-diol (PubChem CID 90981039) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 3-[10-(hydroxymethyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]-4-(6-methoxy-1H-indol-3-yl)-1H-pyrrole-2,5-diol.
| Compound Name | 3-[10-(hydroxymethyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]-4-(6-methoxy-1H-indol-3-yl)-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90981039 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 3-[10-(hydroxymethyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]-4-(6-methoxy-1H-indol-3-yl)-1H-pyrrole-2,5-diol |
| SMILES | COc1ccc2c(-c3c(O)[nH]c(O)c3-c3cn4c5c(cccc35)CC(CO)C4)c[nH]c2c1 |
| InChI | InChI=1S/C25H23N3O4/c1-32-15-5-6-16-18(9-26-20(16)8-15)21-22(25(31)27-24(21)30)19-11-28-10-13(12-29)7-14-3-2-4-17(19)23(14)28/h2-6,8-9,11,13,26-27,29-31H,7,10,12H2,1H3 |
| InChIKey | RMBKUDDSSJTECU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |