C20H21N2O4S3+ — CID 90981986
4-[2-[3-(1,3-benzothiazol-2-yl)prop-1-enyl]-5H-pyrano[2,3-d][1,3]thiazol-3-ium-3-yl]butane-1-sulfonic acid (PubChem CID 90981986) has the molecular formula C20H21N2O4S3+ and a molecular weight of 449.60 g/mol. Its IUPAC name is 4-[2-[3-(1,3-benzothiazol-2-yl)prop-1-enyl]-5H-pyrano[2,3-d][1,3]thiazol-3-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[3-(1,3-benzothiazol-2-yl)prop-1-enyl]-5H-pyrano[2,3-d][1,3]thiazol-3-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 90981986 |
| Molecular Formula | C20H21N2O4S3+ |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 4-[2-[3-(1,3-benzothiazol-2-yl)prop-1-enyl]-5H-pyrano[2,3-d][1,3]thiazol-3-ium-3-yl]butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCC[n+]1c(C=CCc2nc3ccccc3s2)sc2c1OCC=C2 |
| InChI | InChI=1S/C20H20N2O4S3/c23-29(24,25)14-4-3-12-22-19(28-17-9-6-13-26-20(17)22)11-5-10-18-21-15-7-1-2-8-16(15)27-18/h1-2,5-9,11H,3-4,10,12-14H2/p+1 |
| InChIKey | XWYRNMIFMPKSII-UHFFFAOYSA-O |
| XLogP | 3.97 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|