C23H25N2S2+ — CID 90706695
2-[3-(1,3-benzothiazol-2-yl)prop-1-enyl]-3,4-dipropyl-1,3-benzothiazol-3-ium (PubChem CID 90706695) has the molecular formula C23H25N2S2+ and a molecular weight of 393.60 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yl)prop-1-enyl]-3,4-dipropyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yl)prop-1-enyl]-3,4-dipropyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 90706695 |
| Molecular Formula | C23H25N2S2+ |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yl)prop-1-enyl]-3,4-dipropyl-1,3-benzothiazol-3-ium |
| SMILES | CCCc1cccc2sc(C=CCc3nc4ccccc4s3)[n+](CCC)c12 |
| InChI | InChI=1S/C23H25N2S2/c1-3-9-17-10-7-13-20-23(17)25(16-4-2)22(27-20)15-8-14-21-24-18-11-5-6-12-19(18)26-21/h5-8,10-13,15H,3-4,9,14,16H2,1-2H3/q+1 |
| InChIKey | GWFSHYZGHQDBDR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|