C21H14ClFN5O+ — CID 90986850
5-(4-chlorophenyl)-3-[[2-(2-fluorophenyl)-3H-imidazo[4,5-d]pyridazin-5-ium-5-yl]methyl]-1,2-oxazole (PubChem CID 90986850) has the molecular formula C21H14ClFN5O+ and a molecular weight of 406.83 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[[2-(2-fluorophenyl)-3H-imidazo[4,5-d]pyridazin-5-ium-5-yl]methyl]-1,2-oxazole.
| Compound Name | 5-(4-chlorophenyl)-3-[[2-(2-fluorophenyl)-3H-imidazo[4,5-d]pyridazin-5-ium-5-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 90986850 |
| Molecular Formula | C21H14ClFN5O+ |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[[2-(2-fluorophenyl)-3H-imidazo[4,5-d]pyridazin-5-ium-5-yl]methyl]-1,2-oxazole |
| SMILES | Fc1ccccc1-c1nc2cn[n+](Cc3cc(-c4ccc(Cl)cc4)on3)cc2[nH]1 |
| InChI | InChI=1S/C21H13ClFN5O/c22-14-7-5-13(6-8-14)20-9-15(27-29-20)11-28-12-19-18(10-24-28)25-21(26-19)16-3-1-2-4-17(16)23/h1-10,12H,11H2/p+1 |
| InChIKey | XHGOBPPFYYSBGU-UHFFFAOYSA-O |
| XLogP | 4.41 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|