C21H13ClF2N5O+ — CID 90695641
2-(4-chlorophenyl)-5-[[2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]-1,3,4-oxadiazole (PubChem CID 90695641) has the molecular formula C21H13ClF2N5O+ and a molecular weight of 424.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-[[2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-chlorophenyl)-5-[[2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 90695641 |
| Molecular Formula | C21H13ClF2N5O+ |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-(4-chlorophenyl)-5-[[2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]-1,3,4-oxadiazole |
| SMILES | Fc1cccc(-c2nc3cc[n+](Cc4nnc(-c5ccc(Cl)cc5)o4)cc3[nH]2)c1F |
| InChI | InChI=1S/C21H12ClF2N5O/c22-13-6-4-12(5-7-13)21-28-27-18(30-21)11-29-9-8-16-17(10-29)26-20(25-16)14-2-1-3-15(23)19(14)24/h1-10H,11H2/p+1 |
| InChIKey | WJANCEVSBKSUFP-UHFFFAOYSA-O |
| XLogP | 4.55 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|