C25H17F3N3+ — CID 90838191
2-(2,3-difluorophenyl)-5-[(2-fluoro-4-phenylphenyl)methyl]-3H-imidazo[4,5-c]pyridin-5-ium (PubChem CID 90838191) has the molecular formula C25H17F3N3+ and a molecular weight of 416.43 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-5-[(2-fluoro-4-phenylphenyl)methyl]-3H-imidazo[4,5-c]pyridin-5-ium.
| Compound Name | 2-(2,3-difluorophenyl)-5-[(2-fluoro-4-phenylphenyl)methyl]-3H-imidazo[4,5-c]pyridin-5-ium |
|---|---|
| PubChem CID | 90838191 |
| Molecular Formula | C25H17F3N3+ |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-(2,3-difluorophenyl)-5-[(2-fluoro-4-phenylphenyl)methyl]-3H-imidazo[4,5-c]pyridin-5-ium |
| SMILES | Fc1cc(-c2ccccc2)ccc1C[n+]1ccc2nc(-c3cccc(F)c3F)[nH]c2c1 |
| InChI | InChI=1S/C25H16F3N3/c26-20-8-4-7-19(24(20)28)25-29-22-11-12-31(15-23(22)30-25)14-18-10-9-17(13-21(18)27)16-5-2-1-3-6-16/h1-13,15H,14H2/p+1 |
| InChIKey | RZDVWRJIDHNVNM-UHFFFAOYSA-O |
| XLogP | 5.65 |
| TPSA | 32.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|