C26H17F2N4+ — CID 91614976
3-[4-[[2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]phenyl]benzonitrile (PubChem CID 91614976) has the molecular formula C26H17F2N4+ and a molecular weight of 423.45 g/mol. Its IUPAC name is 3-[4-[[2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]phenyl]benzonitrile.
| Compound Name | 3-[4-[[2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 91614976 |
| Molecular Formula | C26H17F2N4+ |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3-[4-[[2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(C[n+]3ccc4nc(-c5cccc(F)c5F)[nH]c4c3)cc2)c1 |
| InChI | InChI=1S/C26H16F2N4/c27-22-6-2-5-21(25(22)28)26-30-23-11-12-32(16-24(23)31-26)15-17-7-9-19(10-8-17)20-4-1-3-18(13-20)14-29/h1-13,16H,15H2/p+1 |
| InChIKey | UNDBGHRTAXQUCO-UHFFFAOYSA-O |
| XLogP | 5.38 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|