C33H28O9 — CID 90988868
9-(3-methylbut-2-enoxy)-4-[[9-(3-methylbut-2-enoxy)-7-oxofuro[3,2-g]chromen-6-yl]oxymethyl]furo[3,2-g]chromen-7-one (PubChem CID 90988868) has the molecular formula C33H28O9 and a molecular weight of 568.58 g/mol. Its IUPAC name is 9-(3-methylbut-2-enoxy)-4-[[9-(3-methylbut-2-enoxy)-7-oxofuro[3,2-g]chromen-6-yl]oxymethyl]furo[3,2-g]chromen-7-one.
| Compound Name | 9-(3-methylbut-2-enoxy)-4-[[9-(3-methylbut-2-enoxy)-7-oxofuro[3,2-g]chromen-6-yl]oxymethyl]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 90988868 |
| Molecular Formula | C33H28O9 |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | 9-(3-methylbut-2-enoxy)-4-[[9-(3-methylbut-2-enoxy)-7-oxofuro[3,2-g]chromen-6-yl]oxymethyl]furo[3,2-g]chromen-7-one |
| SMILES | CC(C)=CCOc1c2occc2cc2cc(OCc3c4ccoc4c(OCC=C(C)C)c4oc(=O)ccc34)c(=O)oc12 |
| InChI | InChI=1S/C33H28O9/c1-18(2)7-11-38-31-27-20(9-13-36-27)15-21-16-25(33(35)42-28(21)31)40-17-24-22-5-6-26(34)41-30(22)32(39-12-8-19(3)4)29-23(24)10-14-37-29/h5-10,13-16H,11-12,17H2,1-4H3 |
| InChIKey | OJHZQFABVGGDEC-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 114.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|