C16H21N3 — CID 90989031
ethane;4-(imidazol-1-ylmethyl)-2-methyl-1H-isoquinoline (PubChem CID 90989031) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is ethane;4-(imidazol-1-ylmethyl)-2-methyl-1H-isoquinoline.
| Compound Name | ethane;4-(imidazol-1-ylmethyl)-2-methyl-1H-isoquinoline |
|---|---|
| PubChem CID | 90989031 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | ethane;4-(imidazol-1-ylmethyl)-2-methyl-1H-isoquinoline |
| SMILES | CC.CN1C=C(Cn2ccnc2)c2ccccc2C1 |
| InChI | InChI=1S/C14H15N3.C2H6/c1-16-8-12-4-2-3-5-14(12)13(9-16)10-17-7-6-15-11-17;1-2/h2-7,9,11H,8,10H2,1H3;1-2H3 |
| InChIKey | HWOGADWSJSOPNU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |