C11H13NO8 — CID 90990592
2-(2,5-dihydroxypyrrol-1-yl)butane-1,2,4-tricarboxylic acid (PubChem CID 90990592) has the molecular formula C11H13NO8 and a molecular weight of 287.22 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)butane-1,2,4-tricarboxylic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)butane-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 90990592 |
| Molecular Formula | C11H13NO8 |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)butane-1,2,4-tricarboxylic acid |
| SMILES | O=C(O)CCC(CC(=O)O)(C(=O)O)n1c(O)ccc1O |
| InChI | InChI=1S/C11H13NO8/c13-6-1-2-7(14)12(6)11(10(19)20,5-9(17)18)4-3-8(15)16/h1-2,13-14H,3-5H2,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | POZDJSRZBBGGKY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 157.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |