C18H20N2O12 — CID 67320218
2,5-bis(2,5-dioxopyrrolidin-1-yl)hexane-1,2,5,6-tetracarboxylic acid (PubChem CID 67320218) has the molecular formula C18H20N2O12 and a molecular weight of 456.36 g/mol. Its IUPAC name is 2,5-bis(2,5-dioxopyrrolidin-1-yl)hexane-1,2,5,6-tetracarboxylic acid.
| Compound Name | 2,5-bis(2,5-dioxopyrrolidin-1-yl)hexane-1,2,5,6-tetracarboxylic acid |
|---|---|
| PubChem CID | 67320218 |
| Molecular Formula | C18H20N2O12 |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 2,5-bis(2,5-dioxopyrrolidin-1-yl)hexane-1,2,5,6-tetracarboxylic acid |
| SMILES | O=C(O)CC(CCC(CC(=O)O)(C(=O)O)N1C(=O)CCC1=O)(C(=O)O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C18H20N2O12/c21-9-1-2-10(22)19(9)17(15(29)30,7-13(25)26)5-6-18(16(31)32,8-14(27)28)20-11(23)3-4-12(20)24/h1-8H2,(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | YNERZMRUMRJKOS-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 223.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|