C9H12N4O4 — CID 121350328
2-azido-2-(2,5-dioxopyrrolidin-1-yl)pentanoic acid (PubChem CID 121350328) has the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. Its IUPAC name is 2-azido-2-(2,5-dioxopyrrolidin-1-yl)pentanoic acid.
| Compound Name | 2-azido-2-(2,5-dioxopyrrolidin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 121350328 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-azido-2-(2,5-dioxopyrrolidin-1-yl)pentanoic acid |
| SMILES | CCCC(N=[N+]=[N-])(C(=O)O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C9H12N4O4/c1-2-5-9(8(16)17,11-12-10)13-6(14)3-4-7(13)15/h2-5H2,1H3,(H,16,17) |
| InChIKey | QVSAUVQCSBCLCX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|