C10H11NO8S — CID 174928480
2-(2-oxo-5-sulfanylidenepyrrolidin-1-yl)oxypropane-1,2,3-tricarboxylic acid (PubChem CID 174928480) has the molecular formula C10H11NO8S and a molecular weight of 305.26 g/mol. Its IUPAC name is 2-(2-oxo-5-sulfanylidenepyrrolidin-1-yl)oxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-(2-oxo-5-sulfanylidenepyrrolidin-1-yl)oxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 174928480 |
| Molecular Formula | C10H11NO8S |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 2-(2-oxo-5-sulfanylidenepyrrolidin-1-yl)oxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(CC(=O)O)(ON1C(=O)CCC1=S)C(=O)O |
| InChI | InChI=1S/C10H11NO8S/c12-5-1-2-6(20)11(5)19-10(9(17)18,3-7(13)14)4-8(15)16/h1-4H2,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | SSAXUQHRWMVAHT-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|