C6H8N2O4 — CID 90991946
2-[(2,5-dihydroxypyrrol-1-yl)amino]acetic acid (PubChem CID 90991946) has the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. Its IUPAC name is 2-[(2,5-dihydroxypyrrol-1-yl)amino]acetic acid.
| Compound Name | 2-[(2,5-dihydroxypyrrol-1-yl)amino]acetic acid |
|---|---|
| PubChem CID | 90991946 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 2-[(2,5-dihydroxypyrrol-1-yl)amino]acetic acid |
| SMILES | O=C(O)CNn1c(O)ccc1O |
| InChI | InChI=1S/C6H8N2O4/c9-4-1-2-5(10)8(4)7-3-6(11)12/h1-2,7,9-10H,3H2,(H,11,12) |
| InChIKey | MLKCMIQQVVQXGK-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |