About 4,6,9-triazatricyclo[6.1.1.02,6]deca-1(10),2,4,7-tetraene
4,6,9-triazatricyclo[6.1.1.02,6]deca-1(10),2,4,7-tetraene (PubChem CID 90992358) has the molecular formula C7H5N3
and a molecular weight of 131.14 g/mol. Its IUPAC name is 4,6,9-triazatricyclo[6.1.1.02,6]deca-1(10),2,4,7-tetraene.
Analyze 4,6,9-triazatricyclo[6.1.1.02,6]deca-1(10),2,4,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6,9-triazatricyclo[6.1.1.02,6]deca-1(10),2,4,7-tetraene?
The IUPAC name of 4,6,9-triazatricyclo[6.1.1.02,6]deca-1(10),2,4,7-tetraene (CID 90992358) is 4,6,9-triazatricyclo[6.1.1.02,6]deca-1(10),2,4,7-tetraene.
What is the SMILES notation for 4,6,9-triazatricyclo[6.1.1.02,6]deca-1(10),2,4,7-tetraene?
The canonical SMILES for 4,6,9-triazatricyclo[6.1.1.02,6]deca-1(10),2,4,7-tetraene is c1c2cn3cncc3c1N2.
What is the InChIKey of 4,6,9-triazatricyclo[6.1.1.02,6]deca-1(10),2,4,7-tetraene?
The InChIKey is GHDMZKAXIZWPCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3/c1-5-3-10-4-8-2-7(10)6(1)9-5/h1-4,9H.
What are the key properties of 4,6,9-triazatricyclo[6.1.1.02,6]deca-1(10),2,4,7-tetraene?
4,6,9-triazatricyclo[6.1.1.02,6]deca-1(10),2,4,7-tetraene has a molecular weight of 131.14 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6,9-triazatricyclo[6.1.1.02,6]deca-1(10),2,4,7-tetraene is sourced from PubChem (CID 90992358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).