C8H6N4 — CID 76849831
6-methylimidazo[1,5-a]pyrazine-8-carbonitrile (PubChem CID 76849831) has the molecular formula C8H6N4 and a molecular weight of 158.16 g/mol. Its IUPAC name is 6-methylimidazo[1,5-a]pyrazine-8-carbonitrile.
| Compound Name | 6-methylimidazo[1,5-a]pyrazine-8-carbonitrile |
|---|---|
| PubChem CID | 76849831 |
| Molecular Formula | C8H6N4 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 6-methylimidazo[1,5-a]pyrazine-8-carbonitrile |
| SMILES | Cc1cn2cncc2c(C#N)n1 |
| InChI | InChI=1S/C8H6N4/c1-6-4-12-5-10-3-8(12)7(2-9)11-6/h3-5H,1H3 |
| InChIKey | NNZVGGCMDXGVQQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |