C21H28N4O4 — CID 90992660
3-[[4-(cyclohexen-1-ylamino)-1-ethyl-2,5-dihydroxypyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 90992660) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-[[4-(cyclohexen-1-ylamino)-1-ethyl-2,5-dihydroxypyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[4-(cyclohexen-1-ylamino)-1-ethyl-2,5-dihydroxypyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 90992660 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 3-[[4-(cyclohexen-1-ylamino)-1-ethyl-2,5-dihydroxypyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CCn1c(O)c(NC2=CCCCC2)c(Nc2cccc(C(=O)N(C)C)c2O)c1O |
| InChI | InChI=1S/C21H28N4O4/c1-4-25-20(28)16(22-13-9-6-5-7-10-13)17(21(25)29)23-15-12-8-11-14(18(15)26)19(27)24(2)3/h8-9,11-12,22-23,26,28-29H,4-7,10H2,1-3H3 |
| InChIKey | DUFVESQZMDSSPK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|