C22H21NO2 — CID 90992795
1-phenacylspiro[4H-isoquinoline-3,4'-cyclohexane]-1'-one (PubChem CID 90992795) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-phenacylspiro[4H-isoquinoline-3,4'-cyclohexane]-1'-one.
| Compound Name | 1-phenacylspiro[4H-isoquinoline-3,4'-cyclohexane]-1'-one |
|---|---|
| PubChem CID | 90992795 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-phenacylspiro[4H-isoquinoline-3,4'-cyclohexane]-1'-one |
| SMILES | O=C1CCC2(CC1)Cc1ccccc1C(CC(=O)c1ccccc1)=N2 |
| InChI | InChI=1S/C22H21NO2/c24-18-10-12-22(13-11-18)15-17-8-4-5-9-19(17)20(23-22)14-21(25)16-6-2-1-3-7-16/h1-9H,10-15H2 |
| InChIKey | WUWFDTIAJCHMCP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |