C21H21NO2 — CID 90994062
2-(6-acetyl-3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylethanone (PubChem CID 90994062) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-(6-acetyl-3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylethanone.
| Compound Name | 2-(6-acetyl-3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 90994062 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-(6-acetyl-3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylethanone |
| SMILES | CC(=O)c1ccc2c(c1)CC(C)(C)N=C2CC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21NO2/c1-14(23)16-9-10-18-17(11-16)13-21(2,3)22-19(18)12-20(24)15-7-5-4-6-8-15/h4-11H,12-13H2,1-3H3 |
| InChIKey | AVWDGVHGBPPNQX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |