C17H29N3O3 — CID 90994904
N-(3-imino-4,4-dimethylpentanoyl)-1-(oxan-4-ylmethyl)azetidine-2-carboxamide (PubChem CID 90994904) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-(3-imino-4,4-dimethylpentanoyl)-1-(oxan-4-ylmethyl)azetidine-2-carboxamide.
| Compound Name | N-(3-imino-4,4-dimethylpentanoyl)-1-(oxan-4-ylmethyl)azetidine-2-carboxamide |
|---|---|
| PubChem CID | 90994904 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | N-(3-imino-4,4-dimethylpentanoyl)-1-(oxan-4-ylmethyl)azetidine-2-carboxamide |
| SMILES | [H]/N=C(/CC(=O)NC(=O)C1CCN1CC1CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C17H29N3O3/c1-17(2,3)14(18)10-15(21)19-16(22)13-4-7-20(13)11-12-5-8-23-9-6-12/h12-13,18H,4-11H2,1-3H3,(H,19,21,22)/b18-14- |
| InChIKey | DQRKHYZACAIQBS-JXAWBTAJSA-N |
| XLogP | 1.59 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|