C18H32N4O3 — CID 90899959
tert-butyl 2-[[C-(2-imino-3,3-dimethylbutyl)-N-methylcarbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 90899959) has the molecular formula C18H32N4O3 and a molecular weight of 352.48 g/mol. Its IUPAC name is tert-butyl 2-[[C-(2-imino-3,3-dimethylbutyl)-N-methylcarbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[C-(2-imino-3,3-dimethylbutyl)-N-methylcarbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90899959 |
| Molecular Formula | C18H32N4O3 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | tert-butyl 2-[[C-(2-imino-3,3-dimethylbutyl)-N-methylcarbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | [H]/N=C(/C/C(=N\C)NC(=O)C1CCCN1C(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H32N4O3/c1-17(2,3)13(19)11-14(20-7)21-15(23)12-9-8-10-22(12)16(24)25-18(4,5)6/h12,19H,8-11H2,1-7H3,(H,20,21,23)/b19-13- |
| InChIKey | DEEVMFPESXNTBA-UYRXBGFRSA-N |
| XLogP | 2.99 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|