About tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate
tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 123959845) has the molecular formula C15H23N3O3
and a molecular weight of 293.37 g/mol. Its IUPAC name is tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate |
| PubChem CID | 123959845 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | C=C/N=C(\C=C)NC(=O)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23N3O3/c1-6-12(16-7-2)17-13(19)11-9-8-10-18(11)14(20)21-15(3,4)5/h6-7,11H,1-2,8-10H2,3-5H3,(H,16,17,19) |
| InChIKey | MRKNAZQHPIFIMV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate (CID 123959845) is tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate is C=C/N=C(\C=C)NC(=O)C1CCCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate?
The InChIKey is MRKNAZQHPIFIMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O3/c1-6-12(16-7-2)17-13(19)11-9-8-10-18(11)14(20)21-15(3,4)5/h6-7,11H,1-2,8-10H2,3-5H3,(H,16,17,19).
What are the key properties of tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate?
tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate has a molecular weight of 293.37 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[[C,N-bis(ethenyl)carbonimidoyl]carbamoyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 123959845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).