C18H32N2O5 — CID 143405049
tert-butyl 2-(cyclopropylcarbamoyl)pyrrolidine-1-carboxylate;ethene;ethyl formate (PubChem CID 143405049) has the molecular formula C18H32N2O5 and a molecular weight of 356.46 g/mol. Its IUPAC name is tert-butyl 2-(cyclopropylcarbamoyl)pyrrolidine-1-carboxylate;ethene;ethyl formate.
| Compound Name | tert-butyl 2-(cyclopropylcarbamoyl)pyrrolidine-1-carboxylate;ethene;ethyl formate |
|---|---|
| PubChem CID | 143405049 |
| Molecular Formula | C18H32N2O5 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | tert-butyl 2-(cyclopropylcarbamoyl)pyrrolidine-1-carboxylate;ethene;ethyl formate |
| SMILES | C=C.CC(C)(C)OC(=O)N1CCCC1C(=O)NC1CC1.CCOC=O |
| InChI | InChI=1S/C13H22N2O3.C3H6O2.C2H4/c1-13(2,3)18-12(17)15-8-4-5-10(15)11(16)14-9-6-7-9;1-2-5-3-4;1-2/h9-10H,4-8H2,1-3H3,(H,14,16);3H,2H2,1H3;1-2H2 |
| InChIKey | VUAIBWWWVDTVHC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|